C23H33N5O3 — CID 68583351
ethyl 8-cyclohexyl-5-oxo-2-(3-pyrrolidin-1-ylpropylamino)pyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 68583351) has the molecular formula C23H33N5O3 and a molecular weight of 427.55 g/mol. Its IUPAC name is ethyl 8-cyclohexyl-5-oxo-2-(3-pyrrolidin-1-ylpropylamino)pyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 8-cyclohexyl-5-oxo-2-(3-pyrrolidin-1-ylpropylamino)pyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 68583351 |
| Molecular Formula | C23H33N5O3 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | ethyl 8-cyclohexyl-5-oxo-2-(3-pyrrolidin-1-ylpropylamino)pyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1cn(C2CCCCC2)c2nc(NCCCN3CCCC3)ncc2c1=O |
| InChI | InChI=1S/C23H33N5O3/c1-2-31-22(30)19-16-28(17-9-4-3-5-10-17)21-18(20(19)29)15-25-23(26-21)24-11-8-14-27-12-6-7-13-27/h15-17H,2-14H2,1H3,(H,24,25,26) |
| InChIKey | OJQRAVAUPUELHH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|