C20H21ClN2O — CID 68583490
(5aS,7S,9aR)-9a-benzyl-7-(2-chloroethynyl)-4,5,5a,6,8,9-hexahydro-1H-benzo[g]indazol-7-ol (PubChem CID 68583490) has the molecular formula C20H21ClN2O and a molecular weight of 340.85 g/mol. Its IUPAC name is (5aS,7S,9aR)-9a-benzyl-7-(2-chloroethynyl)-4,5,5a,6,8,9-hexahydro-1H-benzo[g]indazol-7-ol.
| Compound Name | (5aS,7S,9aR)-9a-benzyl-7-(2-chloroethynyl)-4,5,5a,6,8,9-hexahydro-1H-benzo[g]indazol-7-ol |
|---|---|
| PubChem CID | 68583490 |
| Molecular Formula | C20H21ClN2O |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (5aS,7S,9aR)-9a-benzyl-7-(2-chloroethynyl)-4,5,5a,6,8,9-hexahydro-1H-benzo[g]indazol-7-ol |
| SMILES | O[C@@]1(C#CCl)CC[C@]2(Cc3ccccc3)c3[nH]ncc3CC[C@H]2C1 |
| InChI | InChI=1S/C20H21ClN2O/c21-11-10-19(24)8-9-20(12-15-4-2-1-3-5-15)17(13-19)7-6-16-14-22-23-18(16)20/h1-5,14,17,24H,6-9,12-13H2,(H,22,23)/t17-,19+,20+/m0/s1 |
| InChIKey | CUJQEAKRLWWHKQ-DFQSSKMNSA-N |
| XLogP | 3.57 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|