About Quinoline, 2,4-bis(difluoromethyl)-
Quinoline, 2,4-bis(difluoromethyl)- (PubChem CID 68583804) has the molecular formula C11H7F4N
and a molecular weight of 229.17 g/mol. Its IUPAC name is 2,4-bis(difluoromethyl)quinoline.
Molecular Properties
| Compound Name | Quinoline, 2,4-bis(difluoromethyl)- |
| PubChem CID | 68583804 |
| Molecular Formula | C11H7F4N |
| Molecular Weight | 229.17 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 2,4-bis(difluoromethyl)quinoline |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C(F)F)C(F)F |
| InChI | InChI=1S/C11H7F4N/c12-10(13)7-5-9(11(14)15)16-8-4-2-1-3-6(7)8/h1-5,10-11H |
| InChIKey | LJECGMKCSXJXGA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 12.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | 234 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.17 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze Quinoline, 2,4-bis(difluoromethyl)- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Quinoline, 2,4-bis(difluoromethyl)-?
The IUPAC name of Quinoline, 2,4-bis(difluoromethyl)- (CID 68583804) is 2,4-bis(difluoromethyl)quinoline.
What is the SMILES notation for Quinoline, 2,4-bis(difluoromethyl)-?
The canonical SMILES for Quinoline, 2,4-bis(difluoromethyl)- is C1=CC=C2C(=C1)C(=CC(=N2)C(F)F)C(F)F.
What is the InChIKey of Quinoline, 2,4-bis(difluoromethyl)-?
The InChIKey is LJECGMKCSXJXGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7F4N/c12-10(13)7-5-9(11(14)15)16-8-4-2-1-3-6(7)8/h1-5,10-11H.
What are the key properties of Quinoline, 2,4-bis(difluoromethyl)-?
Quinoline, 2,4-bis(difluoromethyl)- has a molecular weight of 229.17 g/mol, XLogP of 3.50, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Quinoline, 2,4-bis(difluoromethyl)- is sourced from PubChem (CID 68583804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).