C16H14F3N5 — CID 6858396
(E)-1-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 6858396) has the molecular formula C16H14F3N5 and a molecular weight of 333.32 g/mol. Its IUPAC name is (E)-1-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (E)-1-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 6858396 |
| Molecular Formula | C16H14F3N5 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (E)-1-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | Cc1cc(/C=N/n2cnnc2)c(C)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H14F3N5/c1-11-6-13(8-22-23-9-20-21-10-23)12(2)24(11)15-5-3-4-14(7-15)16(17,18)19/h3-10H,1-2H3/b22-8+ |
| InChIKey | DHIAXPDBWKTVFF-GZIVZEMBSA-N |
| XLogP | 3.59 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|