About 6-chloro-4-prop-2-enoxy-2,3-dihydro-1H-indene
6-chloro-4-prop-2-enoxy-2,3-dihydro-1H-indene (PubChem CID 68583970) has the molecular formula C12H13ClO
and a molecular weight of 208.69 g/mol. Its IUPAC name is 6-chloro-4-prop-2-enoxy-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 6-chloro-4-prop-2-enoxy-2,3-dihydro-1H-indene |
| PubChem CID | 68583970 |
| Molecular Formula | C12H13ClO |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 6-chloro-4-prop-2-enoxy-2,3-dihydro-1H-indene |
| SMILES | C=CCOc1cc(Cl)cc2c1CCC2 |
| InChI | InChI=1S/C12H13ClO/c1-2-6-14-12-8-10(13)7-9-4-3-5-11(9)12/h2,7-8H,1,3-6H2 |
| InChIKey | FSHSZHNFHUXXAE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-4-prop-2-enoxy-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-prop-2-enoxy-2,3-dihydro-1H-indene?
The IUPAC name of 6-chloro-4-prop-2-enoxy-2,3-dihydro-1H-indene (CID 68583970) is 6-chloro-4-prop-2-enoxy-2,3-dihydro-1H-indene.
What is the SMILES notation for 6-chloro-4-prop-2-enoxy-2,3-dihydro-1H-indene?
The canonical SMILES for 6-chloro-4-prop-2-enoxy-2,3-dihydro-1H-indene is C=CCOc1cc(Cl)cc2c1CCC2.
What is the InChIKey of 6-chloro-4-prop-2-enoxy-2,3-dihydro-1H-indene?
The InChIKey is FSHSZHNFHUXXAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClO/c1-2-6-14-12-8-10(13)7-9-4-3-5-11(9)12/h2,7-8H,1,3-6H2.
What are the key properties of 6-chloro-4-prop-2-enoxy-2,3-dihydro-1H-indene?
6-chloro-4-prop-2-enoxy-2,3-dihydro-1H-indene has a molecular weight of 208.69 g/mol, XLogP of 3.39, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-prop-2-enoxy-2,3-dihydro-1H-indene is sourced from PubChem (CID 68583970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).