C25H29Cl2N3O2 — CID 68584099
1-[4-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]butyl]-3,4-dihydro-1-benzazepine-2,5-dione (PubChem CID 68584099) has the molecular formula C25H29Cl2N3O2 and a molecular weight of 474.43 g/mol. Its IUPAC name is 1-[4-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]butyl]-3,4-dihydro-1-benzazepine-2,5-dione.
| Compound Name | 1-[4-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]butyl]-3,4-dihydro-1-benzazepine-2,5-dione |
|---|---|
| PubChem CID | 68584099 |
| Molecular Formula | C25H29Cl2N3O2 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 1-[4-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]butyl]-3,4-dihydro-1-benzazepine-2,5-dione |
| SMILES | O=C1CCC(=O)N(CCCCN2CCN(Cc3ccc(Cl)cc3Cl)CC2)c2ccccc21 |
| InChI | InChI=1S/C25H29Cl2N3O2/c26-20-8-7-19(22(27)17-20)18-29-15-13-28(14-16-29)11-3-4-12-30-23-6-2-1-5-21(23)24(31)9-10-25(30)32/h1-2,5-8,17H,3-4,9-16,18H2 |
| InChIKey | GQLODQSFEHUZOZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|