About 1-ethenyl-2-ethylbenzene;1-triphenoxysilylpropan-1-amine
1-ethenyl-2-ethylbenzene;1-triphenoxysilylpropan-1-amine (PubChem CID 68584542) has the molecular formula C31H35NO3Si
and a molecular weight of 497.71 g/mol. Its IUPAC name is 1-ethenyl-2-ethylbenzene;1-triphenoxysilylpropan-1-amine.
Molecular Properties
| Compound Name | 1-ethenyl-2-ethylbenzene;1-triphenoxysilylpropan-1-amine |
| PubChem CID | 68584542 |
| Molecular Formula | C31H35NO3Si |
| Molecular Weight | 497.71 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | 1-ethenyl-2-ethylbenzene;1-triphenoxysilylpropan-1-amine |
| SMILES | C=Cc1ccccc1CC.CCC(N)[Si](Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C21H23NO3Si.C10H12/c1-2-21(22)26(23-18-12-6-3-7-13-18,24-19-14-8-4-9-15-19)25-20-16-10-5-11-17-20;1-3-9-7-5-6-8-10(9)4-2/h3-17,21H,2,22H2,1H3;3,5-8H,1,4H2,2H3 |
| InChIKey | AVCZWSAHWBFZFG-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.71 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-2-ethylbenzene;1-triphenoxysilylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-2-ethylbenzene;1-triphenoxysilylpropan-1-amine?
The IUPAC name of 1-ethenyl-2-ethylbenzene;1-triphenoxysilylpropan-1-amine (CID 68584542) is 1-ethenyl-2-ethylbenzene;1-triphenoxysilylpropan-1-amine.
What is the SMILES notation for 1-ethenyl-2-ethylbenzene;1-triphenoxysilylpropan-1-amine?
The canonical SMILES for 1-ethenyl-2-ethylbenzene;1-triphenoxysilylpropan-1-amine is C=Cc1ccccc1CC.CCC(N)[Si](Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of 1-ethenyl-2-ethylbenzene;1-triphenoxysilylpropan-1-amine?
The InChIKey is AVCZWSAHWBFZFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO3Si.C10H12/c1-2-21(22)26(23-18-12-6-3-7-13-18,24-19-14-8-4-9-15-19)25-20-16-10-5-11-17-20;1-3-9-7-5-6-8-10(9)4-2/h3-17,21H,2,22H2,1H3;3,5-8H,1,4H2,2H3.
What are the key properties of 1-ethenyl-2-ethylbenzene;1-triphenoxysilylpropan-1-amine?
1-ethenyl-2-ethylbenzene;1-triphenoxysilylpropan-1-amine has a molecular weight of 497.71 g/mol, XLogP of 7.33, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-2-ethylbenzene;1-triphenoxysilylpropan-1-amine is sourced from PubChem (CID 68584542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).