C27H26O10 — CID 68585337
4,5-bis(oxane-4-carbonyloxy)-9,10-dioxo-1,2-dihydroanthracene-2-carboxylic acid (PubChem CID 68585337) has the molecular formula C27H26O10 and a molecular weight of 510.50 g/mol. Its IUPAC name is 4,5-bis(oxane-4-carbonyloxy)-9,10-dioxo-1,2-dihydroanthracene-2-carboxylic acid.
| Compound Name | 4,5-bis(oxane-4-carbonyloxy)-9,10-dioxo-1,2-dihydroanthracene-2-carboxylic acid |
|---|---|
| PubChem CID | 68585337 |
| Molecular Formula | C27H26O10 |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 4,5-bis(oxane-4-carbonyloxy)-9,10-dioxo-1,2-dihydroanthracene-2-carboxylic acid |
| SMILES | O=C1C2=C(C(=O)c3c(OC(=O)C4CCOCC4)cccc31)C(OC(=O)C1CCOCC1)=CC(C(=O)O)C2 |
| InChI | InChI=1S/C27H26O10/c28-23-17-2-1-3-19(36-26(32)14-4-8-34-9-5-14)21(17)24(29)22-18(23)12-16(25(30)31)13-20(22)37-27(33)15-6-10-35-11-7-15/h1-3,13-16H,4-12H2,(H,30,31) |
| InChIKey | XUADIXOTANZWJR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|