C30H58O4Si — CID 68585375
ethyl 5-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-9-hydroxy-5,9-dimethyldecanoate (PubChem CID 68585375) has the molecular formula C30H58O4Si and a molecular weight of 510.88 g/mol. Its IUPAC name is ethyl 5-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-9-hydroxy-5,9-dimethyldecanoate.
| Compound Name | ethyl 5-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-9-hydroxy-5,9-dimethyldecanoate |
|---|---|
| PubChem CID | 68585375 |
| Molecular Formula | C30H58O4Si |
| Molecular Weight | 510.88 g/mol |
| Exact Mass | 510.41 |
| IUPAC Name | ethyl 5-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-9-hydroxy-5,9-dimethyldecanoate |
| SMILES | CCOC(=O)CCCC(C)(CCCC(C)(C)O)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C30H58O4Si/c1-11-33-26(31)16-13-20-29(7,21-14-19-28(5,6)32)25-18-17-23-24(15-12-22-30(23,25)8)34-35(9,10)27(2,3)4/h23-25,32H,11-22H2,1-10H3/t23-,24-,25+,29?,30-/m0/s1 |
| InChIKey | ZGNQCUGZHKBBJQ-NJGISSGQSA-N |
| XLogP | 8.27 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.88 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|