C27H28O4 — CID 68585599
3-[4-[5-(1-adamantyl)-2,3-dihydro-1,4-benzodioxin-7-yl]phenyl]prop-2-enoic acid (PubChem CID 68585599) has the molecular formula C27H28O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is 3-[4-[5-(1-adamantyl)-2,3-dihydro-1,4-benzodioxin-7-yl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[5-(1-adamantyl)-2,3-dihydro-1,4-benzodioxin-7-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68585599 |
| Molecular Formula | C27H28O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 3-[4-[5-(1-adamantyl)-2,3-dihydro-1,4-benzodioxin-7-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(-c2cc3c(c(C45CC6CC(CC(C6)C4)C5)c2)OCCO3)cc1 |
| InChI | InChI=1S/C27H28O4/c28-25(29)6-3-17-1-4-21(5-2-17)22-12-23(26-24(13-22)30-7-8-31-26)27-14-18-9-19(15-27)11-20(10-18)16-27/h1-6,12-13,18-20H,7-11,14-16H2,(H,28,29) |
| InChIKey | IPIHMDMTPIWXRA-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|