C12H12N4 — CID 6858576
(E,Z)-2-methyl-3-phenyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine (PubChem CID 6858576) has the molecular formula C12H12N4 and a molecular weight of 212.26 g/mol. Its IUPAC name is (E,Z)-2-methyl-3-phenyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine.
| Compound Name | (E,Z)-2-methyl-3-phenyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 6858576 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | (E,Z)-2-methyl-3-phenyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine |
| SMILES | CC(=C/c1ccccc1)/C=N/n1cnnc1 |
| InChI | InChI=1S/C12H12N4/c1-11(7-12-5-3-2-4-6-12)8-15-16-9-13-14-10-16/h2-10H,1H3/b11-7-,15-8+ |
| InChIKey | TUAGATMTKGEPHX-PDAQCIJPSA-N |
| XLogP | 2.22 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|