About methyl 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate
methyl 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate (PubChem CID 68585795) has the molecular formula C8H6BrN3O2
and a molecular weight of 256.06 g/mol. Its IUPAC name is methyl 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate.
Molecular Properties
| Compound Name | methyl 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate |
| PubChem CID | 68585795 |
| Molecular Formula | C8H6BrN3O2 |
| Molecular Weight | 256.06 g/mol |
| Exact Mass | 254.96 |
| IUPAC Name | methyl 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate |
| SMILES | COC(=O)c1cccc2nc(Br)nn12 |
| InChI | InChI=1S/C8H6BrN3O2/c1-14-7(13)5-3-2-4-6-10-8(9)11-12(5)6/h2-4H,1H3 |
| InChIKey | YBTXISNQOPMXFF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.06 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate?
The IUPAC name of methyl 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate (CID 68585795) is methyl 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate.
What is the SMILES notation for methyl 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate?
The canonical SMILES for methyl 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate is COC(=O)c1cccc2nc(Br)nn12.
What is the InChIKey of methyl 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate?
The InChIKey is YBTXISNQOPMXFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrN3O2/c1-14-7(13)5-3-2-4-6-10-8(9)11-12(5)6/h2-4H,1H3.
What are the key properties of methyl 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate?
methyl 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate has a molecular weight of 256.06 g/mol, XLogP of 1.28, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylate is sourced from PubChem (CID 68585795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).