About (1S)-1-[8-(4-chlorophenyl)-6-methylquinolin-7-yl]ethane-1,2-diol
(1S)-1-[8-(4-chlorophenyl)-6-methylquinolin-7-yl]ethane-1,2-diol (PubChem CID 68585959) has the molecular formula C18H16ClNO2
and a molecular weight of 313.78 g/mol. Its IUPAC name is (1S)-1-[8-(4-chlorophenyl)-6-methylquinolin-7-yl]ethane-1,2-diol.
Molecular Properties
| Compound Name | (1S)-1-[8-(4-chlorophenyl)-6-methylquinolin-7-yl]ethane-1,2-diol |
| PubChem CID | 68585959 |
| Molecular Formula | C18H16ClNO2 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (1S)-1-[8-(4-chlorophenyl)-6-methylquinolin-7-yl]ethane-1,2-diol |
| SMILES | Cc1cc2cccnc2c(-c2ccc(Cl)cc2)c1[C@H](O)CO |
| InChI | InChI=1S/C18H16ClNO2/c1-11-9-13-3-2-8-20-18(13)17(16(11)15(22)10-21)12-4-6-14(19)7-5-12/h2-9,15,21-22H,10H2,1H3/t15-/m1/s1 |
| InChIKey | CQDZNFTYGLNPSP-OAHLLOKOSA-N |
| XLogP | 3.89 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S)-1-[8-(4-chlorophenyl)-6-methylquinolin-7-yl]ethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[8-(4-chlorophenyl)-6-methylquinolin-7-yl]ethane-1,2-diol?
The IUPAC name of (1S)-1-[8-(4-chlorophenyl)-6-methylquinolin-7-yl]ethane-1,2-diol (CID 68585959) is (1S)-1-[8-(4-chlorophenyl)-6-methylquinolin-7-yl]ethane-1,2-diol.
What is the SMILES notation for (1S)-1-[8-(4-chlorophenyl)-6-methylquinolin-7-yl]ethane-1,2-diol?
The canonical SMILES for (1S)-1-[8-(4-chlorophenyl)-6-methylquinolin-7-yl]ethane-1,2-diol is Cc1cc2cccnc2c(-c2ccc(Cl)cc2)c1[C@H](O)CO.
What is the InChIKey of (1S)-1-[8-(4-chlorophenyl)-6-methylquinolin-7-yl]ethane-1,2-diol?
The InChIKey is CQDZNFTYGLNPSP-OAHLLOKOSA-N. The full InChI is InChI=1S/C18H16ClNO2/c1-11-9-13-3-2-8-20-18(13)17(16(11)15(22)10-21)12-4-6-14(19)7-5-12/h2-9,15,21-22H,10H2,1H3/t15-/m1/s1.
What are the key properties of (1S)-1-[8-(4-chlorophenyl)-6-methylquinolin-7-yl]ethane-1,2-diol?
(1S)-1-[8-(4-chlorophenyl)-6-methylquinolin-7-yl]ethane-1,2-diol has a molecular weight of 313.78 g/mol, XLogP of 3.89, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[8-(4-chlorophenyl)-6-methylquinolin-7-yl]ethane-1,2-diol is sourced from PubChem (CID 68585959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).