C21H25FN2O7S — CID 68586027
[(4aR,6R,8aS)-8a-[5-(1-ethoxyethenyl)-2-fluorophenyl]-6-(methoxymethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-carboxycarbamic acid (PubChem CID 68586027) has the molecular formula C21H25FN2O7S and a molecular weight of 468.50 g/mol. Its IUPAC name is [(4aR,6R,8aS)-8a-[5-(1-ethoxyethenyl)-2-fluorophenyl]-6-(methoxymethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-carboxycarbamic acid.
| Compound Name | [(4aR,6R,8aS)-8a-[5-(1-ethoxyethenyl)-2-fluorophenyl]-6-(methoxymethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-carboxycarbamic acid |
|---|---|
| PubChem CID | 68586027 |
| Molecular Formula | C21H25FN2O7S |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | [(4aR,6R,8aS)-8a-[5-(1-ethoxyethenyl)-2-fluorophenyl]-6-(methoxymethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-carboxycarbamic acid |
| SMILES | C=C(OCC)c1ccc(F)c([C@]23CO[C@@H](COC)C[C@H]2CSC(N(C(=O)O)C(=O)O)=N3)c1 |
| InChI | InChI=1S/C21H25FN2O7S/c1-4-30-12(2)13-5-6-17(22)16(7-13)21-11-31-15(9-29-3)8-14(21)10-32-18(23-21)24(19(25)26)20(27)28/h5-7,14-15H,2,4,8-11H2,1,3H3,(H,25,26)(H,27,28)/t14-,15+,21-/m0/s1 |
| InChIKey | ZMXPKQSHRUIGDZ-ZSDSOXJFSA-N |
| XLogP | 3.84 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|