C22H24Cl2N2O4S — CID 68586326
2-[(3,5-dichlorophenyl)sulfonyl-(2,3-dimethyl-1H-indol-5-yl)amino]-3,3-dimethylbutanoic acid (PubChem CID 68586326) has the molecular formula C22H24Cl2N2O4S and a molecular weight of 483.42 g/mol. Its IUPAC name is 2-[(3,5-dichlorophenyl)sulfonyl-(2,3-dimethyl-1H-indol-5-yl)amino]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[(3,5-dichlorophenyl)sulfonyl-(2,3-dimethyl-1H-indol-5-yl)amino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 68586326 |
| Molecular Formula | C22H24Cl2N2O4S |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 2-[(3,5-dichlorophenyl)sulfonyl-(2,3-dimethyl-1H-indol-5-yl)amino]-3,3-dimethylbutanoic acid |
| SMILES | Cc1[nH]c2ccc(N(C(C(=O)O)C(C)(C)C)S(=O)(=O)c3cc(Cl)cc(Cl)c3)cc2c1C |
| InChI | InChI=1S/C22H24Cl2N2O4S/c1-12-13(2)25-19-7-6-16(11-18(12)19)26(20(21(27)28)22(3,4)5)31(29,30)17-9-14(23)8-15(24)10-17/h6-11,20,25H,1-5H3,(H,27,28) |
| InChIKey | GVVSHPYOZWRMGS-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|