About 5-[2-(4-benzylphenoxy)ethyl]imidazo[4,5-c]pyridine;hydrate
5-[2-(4-benzylphenoxy)ethyl]imidazo[4,5-c]pyridine;hydrate (PubChem CID 68586836) has the molecular formula C21H21N3O2
and a molecular weight of 347.42 g/mol. Its IUPAC name is 5-[2-(4-benzylphenoxy)ethyl]imidazo[4,5-c]pyridine;hydrate.
Molecular Properties
| Compound Name | 5-[2-(4-benzylphenoxy)ethyl]imidazo[4,5-c]pyridine;hydrate |
| PubChem CID | 68586836 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 5-[2-(4-benzylphenoxy)ethyl]imidazo[4,5-c]pyridine;hydrate |
| SMILES | O.c1ccc(Cc2ccc(OCCn3ccc4ncnc-4c3)cc2)cc1 |
| InChI | InChI=1S/C21H19N3O.H2O/c1-2-4-17(5-3-1)14-18-6-8-19(9-7-18)25-13-12-24-11-10-20-21(15-24)23-16-22-20;/h1-11,15-16H,12-14H2;1H2 |
| InChIKey | FNVNLWQQJDZNEM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[2-(4-benzylphenoxy)ethyl]imidazo[4,5-c]pyridine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(4-benzylphenoxy)ethyl]imidazo[4,5-c]pyridine;hydrate?
The IUPAC name of 5-[2-(4-benzylphenoxy)ethyl]imidazo[4,5-c]pyridine;hydrate (CID 68586836) is 5-[2-(4-benzylphenoxy)ethyl]imidazo[4,5-c]pyridine;hydrate.
What is the SMILES notation for 5-[2-(4-benzylphenoxy)ethyl]imidazo[4,5-c]pyridine;hydrate?
The canonical SMILES for 5-[2-(4-benzylphenoxy)ethyl]imidazo[4,5-c]pyridine;hydrate is O.c1ccc(Cc2ccc(OCCn3ccc4ncnc-4c3)cc2)cc1.
What is the InChIKey of 5-[2-(4-benzylphenoxy)ethyl]imidazo[4,5-c]pyridine;hydrate?
The InChIKey is FNVNLWQQJDZNEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O.H2O/c1-2-4-17(5-3-1)14-18-6-8-19(9-7-18)25-13-12-24-11-10-20-21(15-24)23-16-22-20;/h1-11,15-16H,12-14H2;1H2.
What are the key properties of 5-[2-(4-benzylphenoxy)ethyl]imidazo[4,5-c]pyridine;hydrate?
5-[2-(4-benzylphenoxy)ethyl]imidazo[4,5-c]pyridine;hydrate has a molecular weight of 347.42 g/mol, XLogP of 3.23, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(4-benzylphenoxy)ethyl]imidazo[4,5-c]pyridine;hydrate is sourced from PubChem (CID 68586836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).