About 3-[2-(dimethylamino)ethyl]-2H-pyridine-2,3-diamine
3-[2-(dimethylamino)ethyl]-2H-pyridine-2,3-diamine (PubChem CID 68586961) has the molecular formula C9H18N4
and a molecular weight of 182.27 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-2H-pyridine-2,3-diamine.
Molecular Properties
| Compound Name | 3-[2-(dimethylamino)ethyl]-2H-pyridine-2,3-diamine |
| PubChem CID | 68586961 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-2H-pyridine-2,3-diamine |
| SMILES | CN(C)CCC1(N)C=CC=NC1N |
| InChI | InChI=1S/C9H18N4/c1-13(2)7-5-9(11)4-3-6-12-8(9)10/h3-4,6,8H,5,7,10-11H2,1-2H3 |
| InChIKey | ZLYURANJOKXSRO-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-(dimethylamino)ethyl]-2H-pyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(dimethylamino)ethyl]-2H-pyridine-2,3-diamine?
The IUPAC name of 3-[2-(dimethylamino)ethyl]-2H-pyridine-2,3-diamine (CID 68586961) is 3-[2-(dimethylamino)ethyl]-2H-pyridine-2,3-diamine.
What is the SMILES notation for 3-[2-(dimethylamino)ethyl]-2H-pyridine-2,3-diamine?
The canonical SMILES for 3-[2-(dimethylamino)ethyl]-2H-pyridine-2,3-diamine is CN(C)CCC1(N)C=CC=NC1N.
What is the InChIKey of 3-[2-(dimethylamino)ethyl]-2H-pyridine-2,3-diamine?
The InChIKey is ZLYURANJOKXSRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4/c1-13(2)7-5-9(11)4-3-6-12-8(9)10/h3-4,6,8H,5,7,10-11H2,1-2H3.
What are the key properties of 3-[2-(dimethylamino)ethyl]-2H-pyridine-2,3-diamine?
3-[2-(dimethylamino)ethyl]-2H-pyridine-2,3-diamine has a molecular weight of 182.27 g/mol, XLogP of -0.44, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(dimethylamino)ethyl]-2H-pyridine-2,3-diamine is sourced from PubChem (CID 68586961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).