About 1-[(3,5-difluorophenyl)methylsulfonylmethyl]-3,5-difluorobenzene
1-[(3,5-difluorophenyl)methylsulfonylmethyl]-3,5-difluorobenzene (PubChem CID 68587062) has the molecular formula C14H10F4O2S
and a molecular weight of 318.29 g/mol. Its IUPAC name is 1-[(3,5-difluorophenyl)methylsulfonylmethyl]-3,5-difluorobenzene.
Molecular Properties
| Compound Name | 1-[(3,5-difluorophenyl)methylsulfonylmethyl]-3,5-difluorobenzene |
| PubChem CID | 68587062 |
| Molecular Formula | C14H10F4O2S |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 1-[(3,5-difluorophenyl)methylsulfonylmethyl]-3,5-difluorobenzene |
| SMILES | O=S(=O)(Cc1cc(F)cc(F)c1)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H10F4O2S/c15-11-1-9(2-12(16)5-11)7-21(19,20)8-10-3-13(17)6-14(18)4-10/h1-6H,7-8H2 |
| InChIKey | VWTSLCKENXNSAC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(3,5-difluorophenyl)methylsulfonylmethyl]-3,5-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-difluorophenyl)methylsulfonylmethyl]-3,5-difluorobenzene?
The IUPAC name of 1-[(3,5-difluorophenyl)methylsulfonylmethyl]-3,5-difluorobenzene (CID 68587062) is 1-[(3,5-difluorophenyl)methylsulfonylmethyl]-3,5-difluorobenzene.
What is the SMILES notation for 1-[(3,5-difluorophenyl)methylsulfonylmethyl]-3,5-difluorobenzene?
The canonical SMILES for 1-[(3,5-difluorophenyl)methylsulfonylmethyl]-3,5-difluorobenzene is O=S(=O)(Cc1cc(F)cc(F)c1)Cc1cc(F)cc(F)c1.
What is the InChIKey of 1-[(3,5-difluorophenyl)methylsulfonylmethyl]-3,5-difluorobenzene?
The InChIKey is VWTSLCKENXNSAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F4O2S/c15-11-1-9(2-12(16)5-11)7-21(19,20)8-10-3-13(17)6-14(18)4-10/h1-6H,7-8H2.
What are the key properties of 1-[(3,5-difluorophenyl)methylsulfonylmethyl]-3,5-difluorobenzene?
1-[(3,5-difluorophenyl)methylsulfonylmethyl]-3,5-difluorobenzene has a molecular weight of 318.29 g/mol, XLogP of 3.36, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-difluorophenyl)methylsulfonylmethyl]-3,5-difluorobenzene is sourced from PubChem (CID 68587062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).