C20H15ClN6 — CID 68587338
5-[2-(chloromethyl)-3H-benzimidazol-5-yl]-N-phenyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 68587338) has the molecular formula C20H15ClN6 and a molecular weight of 374.84 g/mol. Its IUPAC name is 5-[2-(chloromethyl)-3H-benzimidazol-5-yl]-N-phenyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 5-[2-(chloromethyl)-3H-benzimidazol-5-yl]-N-phenyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 68587338 |
| Molecular Formula | C20H15ClN6 |
| Molecular Weight | 374.84 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 5-[2-(chloromethyl)-3H-benzimidazol-5-yl]-N-phenyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | ClCc1nc2ccc(-c3cccc4nc(Nc5ccccc5)nn34)cc2[nH]1 |
| InChI | InChI=1S/C20H15ClN6/c21-12-18-23-15-10-9-13(11-16(15)24-18)17-7-4-8-19-25-20(26-27(17)19)22-14-5-2-1-3-6-14/h1-11H,12H2,(H,22,26)(H,23,24) |
| InChIKey | PCVUDCWCZQUFGK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.84 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|