C18H19N3O — CID 6858751
4,6-dimethyl-2-oxo-1-[(E)-(2,4,6-trimethylphenyl)methylideneamino]pyridine-3-carbonitrile (PubChem CID 6858751) has the molecular formula C18H19N3O and a molecular weight of 293.37 g/mol. Its IUPAC name is 4,6-dimethyl-2-oxo-1-[(E)-(2,4,6-trimethylphenyl)methylideneamino]pyridine-3-carbonitrile.
| Compound Name | 4,6-dimethyl-2-oxo-1-[(E)-(2,4,6-trimethylphenyl)methylideneamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 6858751 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 4,6-dimethyl-2-oxo-1-[(E)-(2,4,6-trimethylphenyl)methylideneamino]pyridine-3-carbonitrile |
| SMILES | Cc1cc(C)c(/C=N/n2c(C)cc(C)c(C#N)c2=O)c(C)c1 |
| InChI | InChI=1S/C18H19N3O/c1-11-6-12(2)17(13(3)7-11)10-20-21-15(5)8-14(4)16(9-19)18(21)22/h6-8,10H,1-5H3/b20-10+ |
| InChIKey | RVAWCIVCQXQAJS-KEBDBYFISA-N |
| XLogP | 3.14 |
| TPSA | 58.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|