C21H28ClNO4S — CID 68587533
(3S,4aS,6S,8aR)-6-(5-chloro-2-ethoxycarbonylphenyl)sulfanyl-1-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid (PubChem CID 68587533) has the molecular formula C21H28ClNO4S and a molecular weight of 425.98 g/mol. Its IUPAC name is (3S,4aS,6S,8aR)-6-(5-chloro-2-ethoxycarbonylphenyl)sulfanyl-1-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid.
| Compound Name | (3S,4aS,6S,8aR)-6-(5-chloro-2-ethoxycarbonylphenyl)sulfanyl-1-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 68587533 |
| Molecular Formula | C21H28ClNO4S |
| Molecular Weight | 425.98 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | (3S,4aS,6S,8aR)-6-(5-chloro-2-ethoxycarbonylphenyl)sulfanyl-1-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid |
| SMILES | CCOC(=O)c1ccc(Cl)cc1S[C@H]1CC[C@H]2C(CC)N[C@H](C(=O)O)C[C@H]2C1 |
| InChI | InChI=1S/C21H28ClNO4S/c1-3-17-15-8-6-14(9-12(15)10-18(23-17)20(24)25)28-19-11-13(22)5-7-16(19)21(26)27-4-2/h5,7,11-12,14-15,17-18,23H,3-4,6,8-10H2,1-2H3,(H,24,25)/t12-,14+,15-,17?,18+/m1/s1 |
| InChIKey | WCKBYZZXVCHWEZ-HBSOEKOESA-N |
| XLogP | 4.62 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.98 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |