C21H19N5O — CID 68587733
ethyl 3-(2-anilino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzenecarboximidate (PubChem CID 68587733) has the molecular formula C21H19N5O and a molecular weight of 357.42 g/mol. Its IUPAC name is ethyl 3-(2-anilino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzenecarboximidate.
| Compound Name | ethyl 3-(2-anilino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzenecarboximidate |
|---|---|
| PubChem CID | 68587733 |
| Molecular Formula | C21H19N5O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | ethyl 3-(2-anilino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzenecarboximidate |
| SMILES | [H]/N=C(\OCC)c1cccc(-c2cccc3nc(Nc4ccccc4)nn23)c1 |
| InChI | InChI=1S/C21H19N5O/c1-2-27-20(22)16-9-6-8-15(14-16)18-12-7-13-19-24-21(25-26(18)19)23-17-10-4-3-5-11-17/h3-14,22H,2H2,1H3,(H,23,25)/b22-20- |
| InChIKey | GTGUTLLFDOZLPU-XDOYNYLZSA-N |
| XLogP | 4.50 |
| TPSA | 75.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|