C32H66O3Si2 — CID 68587917
6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyloctan-2-ol (PubChem CID 68587917) has the molecular formula C32H66O3Si2 and a molecular weight of 555.05 g/mol. Its IUPAC name is 6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyloctan-2-ol.
| Compound Name | 6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyloctan-2-ol |
|---|---|
| PubChem CID | 68587917 |
| Molecular Formula | C32H66O3Si2 |
| Molecular Weight | 555.05 g/mol |
| Exact Mass | 554.46 |
| IUPAC Name | 6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyloctan-2-ol |
| SMILES | CC(C)(O)CCCC(C)(CCO[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C32H66O3Si2/c1-28(2,3)36(11,12)34-24-23-31(9,21-16-20-30(7,8)33)27-19-18-25-26(17-15-22-32(25,27)10)35-37(13,14)29(4,5)6/h25-27,33H,15-24H2,1-14H3/t25-,26-,27+,31?,32-/m0/s1 |
| InChIKey | KEAWULUSGSCARS-IUTBTUCYSA-N |
| XLogP | 9.95 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.05 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|