C15H11N5 — CID 68588332
3-(2-anilino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)prop-2-enenitrile (PubChem CID 68588332) has the molecular formula C15H11N5 and a molecular weight of 261.29 g/mol. Its IUPAC name is 3-(2-anilino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)prop-2-enenitrile.
| Compound Name | 3-(2-anilino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 68588332 |
| Molecular Formula | C15H11N5 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 3-(2-anilino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)prop-2-enenitrile |
| SMILES | N#CC=Cc1cccc2nc(Nc3ccccc3)nn12 |
| InChI | InChI=1S/C15H11N5/c16-11-5-9-13-8-4-10-14-18-15(19-20(13)14)17-12-6-2-1-3-7-12/h1-10H,(H,17,19) |
| InChIKey | SFVVUGVXLSIQFZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|