About N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide
N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 685884) has the molecular formula C12H10Cl2N2OS
and a molecular weight of 301.20 g/mol. Its IUPAC name is N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 685884 |
| Molecular Formula | C12H10Cl2N2OS |
| Molecular Weight | 301.20 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1ncc(Cc2cc(Cl)ccc2Cl)s1 |
| InChI | InChI=1S/C12H10Cl2N2OS/c1-7(17)16-12-15-6-10(18-12)5-8-4-9(13)2-3-11(8)14/h2-4,6H,5H2,1H3,(H,15,16,17) |
| InChIKey | UDXIXURLORNTCF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.20 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide?
The IUPAC name of N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide (CID 685884) is N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide is CC(=O)Nc1ncc(Cc2cc(Cl)ccc2Cl)s1.
What is the InChIKey of N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide?
The InChIKey is UDXIXURLORNTCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl2N2OS/c1-7(17)16-12-15-6-10(18-12)5-8-4-9(13)2-3-11(8)14/h2-4,6H,5H2,1H3,(H,15,16,17).
What are the key properties of N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide?
N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide has a molecular weight of 301.20 g/mol, XLogP of 4.00, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 685884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).