C18H21Cl2NOS — CID 68588500
2-amino-5-[2-chloro-4-(3-chlorophenyl)sulfanylphenyl]-2-methylpentan-1-ol (PubChem CID 68588500) has the molecular formula C18H21Cl2NOS and a molecular weight of 370.35 g/mol. Its IUPAC name is 2-amino-5-[2-chloro-4-(3-chlorophenyl)sulfanylphenyl]-2-methylpentan-1-ol.
| Compound Name | 2-amino-5-[2-chloro-4-(3-chlorophenyl)sulfanylphenyl]-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 68588500 |
| Molecular Formula | C18H21Cl2NOS |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 2-amino-5-[2-chloro-4-(3-chlorophenyl)sulfanylphenyl]-2-methylpentan-1-ol |
| SMILES | CC(N)(CO)CCCc1ccc(Sc2cccc(Cl)c2)cc1Cl |
| InChI | InChI=1S/C18H21Cl2NOS/c1-18(21,12-22)9-3-4-13-7-8-16(11-17(13)20)23-15-6-2-5-14(19)10-15/h2,5-8,10-11,22H,3-4,9,12,21H2,1H3 |
| InChIKey | JIJJCMKTBAQEEU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |