C33H32F5N7O5 — CID 68588557
3-[8-(2,6-difluorophenyl)-2-[2-(dimethylamino)ethylamino]-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-N-(4-methoxyphenyl)-4-methylbenzamide;2,2,2-trifluoroacetic acid (PubChem CID 68588557) has the molecular formula C33H32F5N7O5 and a molecular weight of 701.65 g/mol. Its IUPAC name is 3-[8-(2,6-difluorophenyl)-2-[2-(dimethylamino)ethylamino]-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-N-(4-methoxyphenyl)-4-methylbenzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[8-(2,6-difluorophenyl)-2-[2-(dimethylamino)ethylamino]-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-N-(4-methoxyphenyl)-4-methylbenzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68588557 |
| Molecular Formula | C33H32F5N7O5 |
| Molecular Weight | 701.65 g/mol |
| Exact Mass | 701.24 |
| IUPAC Name | 3-[8-(2,6-difluorophenyl)-2-[2-(dimethylamino)ethylamino]-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-N-(4-methoxyphenyl)-4-methylbenzamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(NC(=O)c2ccc(C)c(-c3nc(NCCN(C)C)nc4c3CNC(=O)N4c3c(F)cccc3F)c2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C31H31F2N7O3.C2HF3O2/c1-18-8-9-19(29(41)36-20-10-12-21(43-4)13-11-20)16-22(18)26-23-17-35-31(42)40(27-24(32)6-5-7-25(27)33)28(23)38-30(37-26)34-14-15-39(2)3;3-2(4,5)1(6)7/h5-13,16H,14-15,17H2,1-4H3,(H,35,42)(H,36,41)(H,34,37,38);(H,6,7) |
| InChIKey | SXXLRIQLYJOGGR-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 149.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.65 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |