C16H15BrN6O4 — CID 68588601
tert-butyl N-[4-(2-bromo-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)-2-nitrophenyl]carbamate (PubChem CID 68588601) has the molecular formula C16H15BrN6O4 and a molecular weight of 435.24 g/mol. Its IUPAC name is tert-butyl N-[4-(2-bromo-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)-2-nitrophenyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-bromo-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)-2-nitrophenyl]carbamate |
|---|---|
| PubChem CID | 68588601 |
| Molecular Formula | C16H15BrN6O4 |
| Molecular Weight | 435.24 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | tert-butyl N-[4-(2-bromo-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)-2-nitrophenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(-c2nccc3nc(Br)nn23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15BrN6O4/c1-16(2,3)27-15(24)19-10-5-4-9(8-11(10)23(25)26)13-18-7-6-12-20-14(17)21-22(12)13/h4-8H,1-3H3,(H,19,24) |
| InChIKey | HOIFYNZXJKSIHA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.24 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|