About [(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-(2H-tetrazol-5-yl)propan-2-yl]carbamic acid
[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-(2H-tetrazol-5-yl)propan-2-yl]carbamic acid (PubChem CID 68588705) has the molecular formula C11H23N5O3Si
and a molecular weight of 301.42 g/mol. Its IUPAC name is [(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-(2H-tetrazol-5-yl)propan-2-yl]carbamic acid.
Molecular Properties
| Compound Name | [(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-(2H-tetrazol-5-yl)propan-2-yl]carbamic acid |
| PubChem CID | 68588705 |
| Molecular Formula | C11H23N5O3Si |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | [(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-(2H-tetrazol-5-yl)propan-2-yl]carbamic acid |
| SMILES | C[C@H](NC(=O)O)[C@H](O[Si](C)(C)C(C)(C)C)c1nn[nH]n1 |
| InChI | InChI=1S/C11H23N5O3Si/c1-7(12-10(17)18)8(9-13-15-16-14-9)19-20(5,6)11(2,3)4/h7-8,12H,1-6H3,(H,17,18)(H,13,14,15,16)/t7-,8-/m0/s1 |
| InChIKey | HNLDJYKFSICZTC-YUMQZZPRSA-N |
| XLogP | 1.92 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-(2H-tetrazol-5-yl)propan-2-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-(2H-tetrazol-5-yl)propan-2-yl]carbamic acid?
The IUPAC name of [(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-(2H-tetrazol-5-yl)propan-2-yl]carbamic acid (CID 68588705) is [(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-(2H-tetrazol-5-yl)propan-2-yl]carbamic acid.
What is the SMILES notation for [(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-(2H-tetrazol-5-yl)propan-2-yl]carbamic acid?
The canonical SMILES for [(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-(2H-tetrazol-5-yl)propan-2-yl]carbamic acid is C[C@H](NC(=O)O)[C@H](O[Si](C)(C)C(C)(C)C)c1nn[nH]n1.
What is the InChIKey of [(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-(2H-tetrazol-5-yl)propan-2-yl]carbamic acid?
The InChIKey is HNLDJYKFSICZTC-YUMQZZPRSA-N. The full InChI is InChI=1S/C11H23N5O3Si/c1-7(12-10(17)18)8(9-13-15-16-14-9)19-20(5,6)11(2,3)4/h7-8,12H,1-6H3,(H,17,18)(H,13,14,15,16)/t7-,8-/m0/s1.
What are the key properties of [(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-(2H-tetrazol-5-yl)propan-2-yl]carbamic acid?
[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-(2H-tetrazol-5-yl)propan-2-yl]carbamic acid has a molecular weight of 301.42 g/mol, XLogP of 1.92, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-(2H-tetrazol-5-yl)propan-2-yl]carbamic acid is sourced from PubChem (CID 68588705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).