C16H13N5O2S — CID 6858900
methyl 4-[(E)-(3-pyridin-3-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]benzoate (PubChem CID 6858900) has the molecular formula C16H13N5O2S and a molecular weight of 339.38 g/mol. Its IUPAC name is methyl 4-[(E)-(3-pyridin-3-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]benzoate.
| Compound Name | methyl 4-[(E)-(3-pyridin-3-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]benzoate |
|---|---|
| PubChem CID | 6858900 |
| Molecular Formula | C16H13N5O2S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | methyl 4-[(E)-(3-pyridin-3-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N/n2c(-c3cccnc3)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C16H13N5O2S/c1-23-15(22)12-6-4-11(5-7-12)9-18-21-14(19-20-16(21)24)13-3-2-8-17-10-13/h2-10H,1H3,(H,20,24)/b18-9+ |
| InChIKey | CPBAUKPBMVIBSC-GIJQJNRQSA-N |
| XLogP | 2.67 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|