About 1-[(E)-but-1-enyl]-2,3,4,5-tetramethyltriazole
1-[(E)-but-1-enyl]-2,3,4,5-tetramethyltriazole (PubChem CID 68589608) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-[(E)-but-1-enyl]-2,3,4,5-tetramethyltriazole.
Molecular Properties
| Compound Name | 1-[(E)-but-1-enyl]-2,3,4,5-tetramethyltriazole |
| PubChem CID | 68589608 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 1-[(E)-but-1-enyl]-2,3,4,5-tetramethyltriazole |
| SMILES | CC/C=C/N1C(C)=C(C)N(C)N1C |
| InChI | InChI=1S/C10H19N3/c1-6-7-8-13-10(3)9(2)11(4)12(13)5/h7-8H,6H2,1-5H3/b8-7+ |
| InChIKey | VPAVIPBPBMIYKU-BQYQJAHWSA-N |
| XLogP | 2.17 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(E)-but-1-enyl]-2,3,4,5-tetramethyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-but-1-enyl]-2,3,4,5-tetramethyltriazole?
The IUPAC name of 1-[(E)-but-1-enyl]-2,3,4,5-tetramethyltriazole (CID 68589608) is 1-[(E)-but-1-enyl]-2,3,4,5-tetramethyltriazole.
What is the SMILES notation for 1-[(E)-but-1-enyl]-2,3,4,5-tetramethyltriazole?
The canonical SMILES for 1-[(E)-but-1-enyl]-2,3,4,5-tetramethyltriazole is CC/C=C/N1C(C)=C(C)N(C)N1C.
What is the InChIKey of 1-[(E)-but-1-enyl]-2,3,4,5-tetramethyltriazole?
The InChIKey is VPAVIPBPBMIYKU-BQYQJAHWSA-N. The full InChI is InChI=1S/C10H19N3/c1-6-7-8-13-10(3)9(2)11(4)12(13)5/h7-8H,6H2,1-5H3/b8-7+.
What are the key properties of 1-[(E)-but-1-enyl]-2,3,4,5-tetramethyltriazole?
1-[(E)-but-1-enyl]-2,3,4,5-tetramethyltriazole has a molecular weight of 181.28 g/mol, XLogP of 2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-but-1-enyl]-2,3,4,5-tetramethyltriazole is sourced from PubChem (CID 68589608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).