C22H35NO6 — CID 68590338
(3aS,5S,6R,6aS)-5-[(benzylamino)methyl]-3a-(2-butoxyethoxymethyl)-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-ol (PubChem CID 68590338) has the molecular formula C22H35NO6 and a molecular weight of 409.52 g/mol. Its IUPAC name is (3aS,5S,6R,6aS)-5-[(benzylamino)methyl]-3a-(2-butoxyethoxymethyl)-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aS,5S,6R,6aS)-5-[(benzylamino)methyl]-3a-(2-butoxyethoxymethyl)-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 68590338 |
| Molecular Formula | C22H35NO6 |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | (3aS,5S,6R,6aS)-5-[(benzylamino)methyl]-3a-(2-butoxyethoxymethyl)-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-ol |
| SMILES | CCCCOCCOC[C@@]12O[C@@H](CNCc3ccccc3)[C@@H](O)[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C22H35NO6/c1-4-5-11-25-12-13-26-16-22-20(28-21(2,3)29-22)19(24)18(27-22)15-23-14-17-9-7-6-8-10-17/h6-10,18-20,23-24H,4-5,11-16H2,1-3H3/t18-,19+,20-,22-/m0/s1 |
| InChIKey | UQLZILHWXVPTDO-IIZPIQPGSA-N |
| XLogP | 2.22 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|