C20H24O5 — CID 6859057
[(3R,3aR,9aR,9bS)-3,6,9-trimethyl-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-3-yl] (E)-2-methylbut-2-enoate (PubChem CID 6859057) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is [(3R,3aR,9aR,9bS)-3,6,9-trimethyl-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-3-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(3R,3aR,9aR,9bS)-3,6,9-trimethyl-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-3-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 6859057 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | [(3R,3aR,9aR,9bS)-3,6,9-trimethyl-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-3-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)O[C@@]1(C)C(=O)O[C@H]2[C@@H]3C(C)=CC(=O)C3=C(C)CC[C@H]21 |
| InChI | InChI=1S/C20H24O5/c1-6-10(2)18(22)25-20(5)13-8-7-11(3)15-14(21)9-12(4)16(15)17(13)24-19(20)23/h6,9,13,16-17H,7-8H2,1-5H3/b10-6+/t13-,16-,17-,20-/m1/s1 |
| InChIKey | AZLPJFDWGKGHHV-BAZASTOASA-N |
| XLogP | 3.05 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|