C26H33Cl2N7O4 — CID 68590714
N'-(5-chloro-2-pyridinyl)-N-[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(6-methyl-7,8-dihydro-5H-1,6-naphthyridine-2-carbonyl)amino]cyclohexyl]oxamide;hydrochloride (PubChem CID 68590714) has the molecular formula C26H33Cl2N7O4 and a molecular weight of 578.50 g/mol. Its IUPAC name is N'-(5-chloro-2-pyridinyl)-N-[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(6-methyl-7,8-dihydro-5H-1,6-naphthyridine-2-carbonyl)amino]cyclohexyl]oxamide;hydrochloride.
| Compound Name | N'-(5-chloro-2-pyridinyl)-N-[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(6-methyl-7,8-dihydro-5H-1,6-naphthyridine-2-carbonyl)amino]cyclohexyl]oxamide;hydrochloride |
|---|---|
| PubChem CID | 68590714 |
| Molecular Formula | C26H33Cl2N7O4 |
| Molecular Weight | 578.50 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | N'-(5-chloro-2-pyridinyl)-N-[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(6-methyl-7,8-dihydro-5H-1,6-naphthyridine-2-carbonyl)amino]cyclohexyl]oxamide;hydrochloride |
| SMILES | CN1CCc2nc(C(=O)N[C@@H]3C[C@@H](C(=O)N(C)C)CC[C@@H]3NC(=O)C(=O)Nc3ccc(Cl)cn3)ccc2C1.Cl |
| InChI | InChI=1S/C26H32ClN7O4.ClH/c1-33(2)26(38)15-4-7-19(30-24(36)25(37)32-22-9-6-17(27)13-28-22)21(12-15)31-23(35)20-8-5-16-14-34(3)11-10-18(16)29-20;/h5-6,8-9,13,15,19,21H,4,7,10-12,14H2,1-3H3,(H,30,36)(H,31,35)(H,28,32,37);1H/t15-,19-,21+;/m0./s1 |
| InChIKey | BQRKHJFDBKDIOD-CPTHBWRSSA-N |
| XLogP | 1.65 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.50 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|