C23H34FNO7 — CID 68591003
N-[[(3aS,5S,6R,6aS)-3a-(2-butoxyethoxymethyl)-6-hydroxy-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-5-yl]methyl]-2-(4-fluorophenyl)acetamide (PubChem CID 68591003) has the molecular formula C23H34FNO7 and a molecular weight of 455.52 g/mol. Its IUPAC name is N-[[(3aS,5S,6R,6aS)-3a-(2-butoxyethoxymethyl)-6-hydroxy-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-5-yl]methyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[[(3aS,5S,6R,6aS)-3a-(2-butoxyethoxymethyl)-6-hydroxy-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-5-yl]methyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 68591003 |
| Molecular Formula | C23H34FNO7 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | N-[[(3aS,5S,6R,6aS)-3a-(2-butoxyethoxymethyl)-6-hydroxy-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-5-yl]methyl]-2-(4-fluorophenyl)acetamide |
| SMILES | CCCCOCCOC[C@@]12O[C@@H](CNC(=O)Cc3ccc(F)cc3)[C@@H](O)[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C23H34FNO7/c1-4-5-10-28-11-12-29-15-23-21(31-22(2,3)32-23)20(27)18(30-23)14-25-19(26)13-16-6-8-17(24)9-7-16/h6-9,18,20-21,27H,4-5,10-15H2,1-3H3,(H,25,26)/t18-,20+,21-,23-/m0/s1 |
| InChIKey | WOHWAQKQSIXZDV-SQMWVJLWSA-N |
| XLogP | 1.93 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|