C23H33F2NO7 — CID 68591069
N-[[(3aS,5S,6R,6aS)-3a-(2-butoxyethoxymethyl)-6-hydroxy-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-5-yl]methyl]-2-(3,4-difluorophenyl)acetamide (PubChem CID 68591069) has the molecular formula C23H33F2NO7 and a molecular weight of 473.51 g/mol. Its IUPAC name is N-[[(3aS,5S,6R,6aS)-3a-(2-butoxyethoxymethyl)-6-hydroxy-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-5-yl]methyl]-2-(3,4-difluorophenyl)acetamide.
| Compound Name | N-[[(3aS,5S,6R,6aS)-3a-(2-butoxyethoxymethyl)-6-hydroxy-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-5-yl]methyl]-2-(3,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 68591069 |
| Molecular Formula | C23H33F2NO7 |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | N-[[(3aS,5S,6R,6aS)-3a-(2-butoxyethoxymethyl)-6-hydroxy-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-5-yl]methyl]-2-(3,4-difluorophenyl)acetamide |
| SMILES | CCCCOCCOC[C@@]12O[C@@H](CNC(=O)Cc3ccc(F)c(F)c3)[C@@H](O)[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C23H33F2NO7/c1-4-5-8-29-9-10-30-14-23-21(32-22(2,3)33-23)20(28)18(31-23)13-26-19(27)12-15-6-7-16(24)17(25)11-15/h6-7,11,18,20-21,28H,4-5,8-10,12-14H2,1-3H3,(H,26,27)/t18-,20+,21-,23-/m0/s1 |
| InChIKey | DPWBCQZRVDUDLT-SQMWVJLWSA-N |
| XLogP | 2.06 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|