C15H9F3N2OS — CID 685913
N-[4-(1,3-benzothiazol-2-yl)phenyl]-2,2,2-trifluoroacetamide (PubChem CID 685913) has the molecular formula C15H9F3N2OS and a molecular weight of 322.31 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-yl)phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 685913 |
| Molecular Formula | C15H9F3N2OS |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1ccc(-c2nc3ccccc3s2)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H9F3N2OS/c16-15(17,18)14(21)19-10-7-5-9(6-8-10)13-20-11-3-1-2-4-12(11)22-13/h1-8H,(H,19,21) |
| InChIKey | YJRNLSYFJPRKEE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |