C14H21F — CID 68591438
1-(2-fluoroethyl)-3,5-di(propan-2-yl)benzene (PubChem CID 68591438) has the molecular formula C14H21F and a molecular weight of 208.32 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-3,5-di(propan-2-yl)benzene.
| Compound Name | 1-(2-fluoroethyl)-3,5-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 68591438 |
| Molecular Formula | C14H21F |
| Molecular Weight | 208.32 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-(2-fluoroethyl)-3,5-di(propan-2-yl)benzene |
| SMILES | CC(C)c1cc(CCF)cc(C(C)C)c1 |
| InChI | InChI=1S/C14H21F/c1-10(2)13-7-12(5-6-15)8-14(9-13)11(3)4/h7-11H,5-6H2,1-4H3 |
| InChIKey | GTGICYPOLZKXBF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |