About 2,3-dihydroisoindol-1-one;isoindole-1,3-dione
2,3-dihydroisoindol-1-one;isoindole-1,3-dione (PubChem CID 68591479) has the molecular formula C16H12N2O3
and a molecular weight of 280.28 g/mol. Its IUPAC name is 2,3-dihydroisoindol-1-one;isoindole-1,3-dione.
Molecular Properties
| Compound Name | 2,3-dihydroisoindol-1-one;isoindole-1,3-dione |
| PubChem CID | 68591479 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2,3-dihydroisoindol-1-one;isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2ccccc21.O=C1NCc2ccccc21 |
| InChI | InChI=1S/C8H5NO2.C8H7NO/c10-7-5-3-1-2-4-6(5)8(11)9-7;10-8-7-4-2-1-3-6(7)5-9-8/h1-4H,(H,9,10,11);1-4H,5H2,(H,9,10) |
| InChIKey | JXOHKKQPJCYVEE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydroisoindol-1-one;isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroisoindol-1-one;isoindole-1,3-dione?
The IUPAC name of 2,3-dihydroisoindol-1-one;isoindole-1,3-dione (CID 68591479) is 2,3-dihydroisoindol-1-one;isoindole-1,3-dione.
What is the SMILES notation for 2,3-dihydroisoindol-1-one;isoindole-1,3-dione?
The canonical SMILES for 2,3-dihydroisoindol-1-one;isoindole-1,3-dione is O=C1NC(=O)c2ccccc21.O=C1NCc2ccccc21.
What is the InChIKey of 2,3-dihydroisoindol-1-one;isoindole-1,3-dione?
The InChIKey is JXOHKKQPJCYVEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2.C8H7NO/c10-7-5-3-1-2-4-6(5)8(11)9-7;10-8-7-4-2-1-3-6(7)5-9-8/h1-4H,(H,9,10,11);1-4H,5H2,(H,9,10).
What are the key properties of 2,3-dihydroisoindol-1-one;isoindole-1,3-dione?
2,3-dihydroisoindol-1-one;isoindole-1,3-dione has a molecular weight of 280.28 g/mol, XLogP of 1.50, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroisoindol-1-one;isoindole-1,3-dione is sourced from PubChem (CID 68591479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).