About 2-(5H-imidazo[1,2-a]pyridin-1-yl)ethanol
2-(5H-imidazo[1,2-a]pyridin-1-yl)ethanol (PubChem CID 68591702) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 2-(5H-imidazo[1,2-a]pyridin-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(5H-imidazo[1,2-a]pyridin-1-yl)ethanol |
| PubChem CID | 68591702 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 2-(5H-imidazo[1,2-a]pyridin-1-yl)ethanol |
| SMILES | OCCN1C=CN2CC=CC=C21 |
| InChI | InChI=1S/C9H12N2O/c12-8-7-11-6-5-10-4-2-1-3-9(10)11/h1-3,5-6,12H,4,7-8H2 |
| InChIKey | XHZLWODLMKECPI-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5H-imidazo[1,2-a]pyridin-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5H-imidazo[1,2-a]pyridin-1-yl)ethanol?
The IUPAC name of 2-(5H-imidazo[1,2-a]pyridin-1-yl)ethanol (CID 68591702) is 2-(5H-imidazo[1,2-a]pyridin-1-yl)ethanol.
What is the SMILES notation for 2-(5H-imidazo[1,2-a]pyridin-1-yl)ethanol?
The canonical SMILES for 2-(5H-imidazo[1,2-a]pyridin-1-yl)ethanol is OCCN1C=CN2CC=CC=C21.
What is the InChIKey of 2-(5H-imidazo[1,2-a]pyridin-1-yl)ethanol?
The InChIKey is XHZLWODLMKECPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c12-8-7-11-6-5-10-4-2-1-3-9(10)11/h1-3,5-6,12H,4,7-8H2.
What are the key properties of 2-(5H-imidazo[1,2-a]pyridin-1-yl)ethanol?
2-(5H-imidazo[1,2-a]pyridin-1-yl)ethanol has a molecular weight of 164.21 g/mol, XLogP of 0.48, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5H-imidazo[1,2-a]pyridin-1-yl)ethanol is sourced from PubChem (CID 68591702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).