C30H34ClF3N4O6 — CID 68592549
diethyl 2-[[4-amino-3-chloro-5-(trifluoromethyl)phenyl]methyl]-2-[2-oxo-2-[4-(2-oxo-1,4-dihydroquinazolin-3-yl)piperidin-1-yl]ethyl]propanedioate (PubChem CID 68592549) has the molecular formula C30H34ClF3N4O6 and a molecular weight of 639.07 g/mol. Its IUPAC name is diethyl 2-[[4-amino-3-chloro-5-(trifluoromethyl)phenyl]methyl]-2-[2-oxo-2-[4-(2-oxo-1,4-dihydroquinazolin-3-yl)piperidin-1-yl]ethyl]propanedioate.
| Compound Name | diethyl 2-[[4-amino-3-chloro-5-(trifluoromethyl)phenyl]methyl]-2-[2-oxo-2-[4-(2-oxo-1,4-dihydroquinazolin-3-yl)piperidin-1-yl]ethyl]propanedioate |
|---|---|
| PubChem CID | 68592549 |
| Molecular Formula | C30H34ClF3N4O6 |
| Molecular Weight | 639.07 g/mol |
| Exact Mass | 638.21 |
| IUPAC Name | diethyl 2-[[4-amino-3-chloro-5-(trifluoromethyl)phenyl]methyl]-2-[2-oxo-2-[4-(2-oxo-1,4-dihydroquinazolin-3-yl)piperidin-1-yl]ethyl]propanedioate |
| SMILES | CCOC(=O)C(CC(=O)N1CCC(N2Cc3ccccc3NC2=O)CC1)(Cc1cc(Cl)c(N)c(C(F)(F)F)c1)C(=O)OCC |
| InChI | InChI=1S/C30H34ClF3N4O6/c1-3-43-26(40)29(27(41)44-4-2,15-18-13-21(30(32,33)34)25(35)22(31)14-18)16-24(39)37-11-9-20(10-12-37)38-17-19-7-5-6-8-23(19)36-28(38)42/h5-8,13-14,20H,3-4,9-12,15-17,35H2,1-2H3,(H,36,42) |
| InChIKey | DEAXOQQOUCLYAR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 131.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.07 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|