C22H24FN3O4 — CID 68593250
2-methylpropyl (3S,3aS)-1-carbamoyl-8-fluoro-3-phenyl-3,3a,4,9b-tetrahydrochromeno[4,3-c]pyrazole-2-carboxylate (PubChem CID 68593250) has the molecular formula C22H24FN3O4 and a molecular weight of 413.45 g/mol. Its IUPAC name is 2-methylpropyl (3S,3aS)-1-carbamoyl-8-fluoro-3-phenyl-3,3a,4,9b-tetrahydrochromeno[4,3-c]pyrazole-2-carboxylate.
| Compound Name | 2-methylpropyl (3S,3aS)-1-carbamoyl-8-fluoro-3-phenyl-3,3a,4,9b-tetrahydrochromeno[4,3-c]pyrazole-2-carboxylate |
|---|---|
| PubChem CID | 68593250 |
| Molecular Formula | C22H24FN3O4 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 2-methylpropyl (3S,3aS)-1-carbamoyl-8-fluoro-3-phenyl-3,3a,4,9b-tetrahydrochromeno[4,3-c]pyrazole-2-carboxylate |
| SMILES | CC(C)COC(=O)N1[C@H](c2ccccc2)[C@H]2COc3ccc(F)cc3C2N1C(N)=O |
| InChI | InChI=1S/C22H24FN3O4/c1-13(2)11-30-22(28)26-19(14-6-4-3-5-7-14)17-12-29-18-9-8-15(23)10-16(18)20(17)25(26)21(24)27/h3-10,13,17,19-20H,11-12H2,1-2H3,(H2,24,27)/t17-,19-,20?/m1/s1 |
| InChIKey | QDFUVBPBKKAYIX-RIBPFEIKSA-N |
| XLogP | 4.02 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |