C21H21ClN6O2 — CID 68593290
2-[[4-[(5-chloro-4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]-3-methoxyphenyl]methylamino]ethanol (PubChem CID 68593290) has the molecular formula C21H21ClN6O2 and a molecular weight of 424.89 g/mol. Its IUPAC name is 2-[[4-[(5-chloro-4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]-3-methoxyphenyl]methylamino]ethanol.
| Compound Name | 2-[[4-[(5-chloro-4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]-3-methoxyphenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 68593290 |
| Molecular Formula | C21H21ClN6O2 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 2-[[4-[(5-chloro-4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]-3-methoxyphenyl]methylamino]ethanol |
| SMILES | COc1cc(CNCCO)ccc1Nc1ncc(Cl)c(-c2cnc3ccccn23)n1 |
| InChI | InChI=1S/C21H21ClN6O2/c1-30-18-10-14(11-23-7-9-29)5-6-16(18)26-21-25-12-15(22)20(27-21)17-13-24-19-4-2-3-8-28(17)19/h2-6,8,10,12-13,23,29H,7,9,11H2,1H3,(H,25,26,27) |
| InChIKey | MFWNGCCZXZDXDT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|