C20H32N2O2 — CID 68593909
3,5,7-trimethyl-N-[(4S)-2-oxoazepan-4-yl]adamantane-1-carboxamide (PubChem CID 68593909) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is 3,5,7-trimethyl-N-[(4S)-2-oxoazepan-4-yl]adamantane-1-carboxamide.
| Compound Name | 3,5,7-trimethyl-N-[(4S)-2-oxoazepan-4-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 68593909 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | 3,5,7-trimethyl-N-[(4S)-2-oxoazepan-4-yl]adamantane-1-carboxamide |
| SMILES | CC12CC3(C)CC(C)(C1)CC(C(=O)N[C@H]1CCCNC(=O)C1)(C2)C3 |
| InChI | InChI=1S/C20H32N2O2/c1-17-8-18(2)10-19(3,9-17)13-20(11-17,12-18)16(24)22-14-5-4-6-21-15(23)7-14/h14H,4-13H2,1-3H3,(H,21,23)(H,22,24)/t14-,17?,18?,19?,20?/m0/s1 |
| InChIKey | ZUJGNFMLBUKYKQ-WMLOPIRWSA-N |
| XLogP | 3.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |