C25H27F3N4O4 — CID 68594242
1-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-3-(1,2,3,4-tetrahydronaphthalen-2-ylmethyl)urea;2,2,2-trifluoroacetic acid (PubChem CID 68594242) has the molecular formula C25H27F3N4O4 and a molecular weight of 504.51 g/mol. Its IUPAC name is 1-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-3-(1,2,3,4-tetrahydronaphthalen-2-ylmethyl)urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-3-(1,2,3,4-tetrahydronaphthalen-2-ylmethyl)urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68594242 |
| Molecular Formula | C25H27F3N4O4 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | 1-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-3-(1,2,3,4-tetrahydronaphthalen-2-ylmethyl)urea;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc(NC(=O)NCC2CCc3ccccc3C2)ccc1-n1cnc(C)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H26N4O2.C2HF3O2/c1-16-14-27(15-25-16)21-10-9-20(12-22(21)29-2)26-23(28)24-13-17-7-8-18-5-3-4-6-19(18)11-17;3-2(4,5)1(6)7/h3-6,9-10,12,14-15,17H,7-8,11,13H2,1-2H3,(H2,24,26,28);(H,6,7) |
| InChIKey | JXCUYBQILFIWNN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |