C17H11ClN4O — CID 6859436
(E)-N-(4-chlorophenyl)-2-cyano-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide (PubChem CID 6859436) has the molecular formula C17H11ClN4O and a molecular weight of 322.76 g/mol. Its IUPAC name is (E)-N-(4-chlorophenyl)-2-cyano-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide.
| Compound Name | (E)-N-(4-chlorophenyl)-2-cyano-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 6859436 |
| Molecular Formula | C17H11ClN4O |
| Molecular Weight | 322.76 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | (E)-N-(4-chlorophenyl)-2-cyano-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide |
| SMILES | N#C/C(=C\c1c[nH]c2ncccc12)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H11ClN4O/c18-13-3-5-14(6-4-13)22-17(23)11(9-19)8-12-10-21-16-15(12)2-1-7-20-16/h1-8,10H,(H,20,21)(H,22,23)/b11-8+ |
| InChIKey | SFLZNOGAGNFRET-DHZHZOJOSA-N |
| XLogP | 3.76 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.76 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|