C26H30F3N9O3 — CID 68594430
N'-(2-cyano-9-methylpurin-6-yl)-N'-cyclopentyl-3-(4-methylpiperazin-1-yl)benzohydrazide;2,2,2-trifluoroacetic acid (PubChem CID 68594430) has the molecular formula C26H30F3N9O3 and a molecular weight of 573.58 g/mol. Its IUPAC name is N'-(2-cyano-9-methylpurin-6-yl)-N'-cyclopentyl-3-(4-methylpiperazin-1-yl)benzohydrazide;2,2,2-trifluoroacetic acid.
| Compound Name | N'-(2-cyano-9-methylpurin-6-yl)-N'-cyclopentyl-3-(4-methylpiperazin-1-yl)benzohydrazide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68594430 |
| Molecular Formula | C26H30F3N9O3 |
| Molecular Weight | 573.58 g/mol |
| Exact Mass | 573.24 |
| IUPAC Name | N'-(2-cyano-9-methylpurin-6-yl)-N'-cyclopentyl-3-(4-methylpiperazin-1-yl)benzohydrazide;2,2,2-trifluoroacetic acid |
| SMILES | CN1CCN(c2cccc(C(=O)NN(c3nc(C#N)nc4c3ncn4C)C3CCCC3)c2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H29N9O.C2HF3O2/c1-30-10-12-32(13-11-30)19-9-5-6-17(14-19)24(34)29-33(18-7-3-4-8-18)23-21-22(31(2)16-26-21)27-20(15-25)28-23;3-2(4,5)1(6)7/h5-6,9,14,16,18H,3-4,7-8,10-13H2,1-2H3,(H,29,34);(H,6,7) |
| InChIKey | QKTKPIXALCMIGY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 143.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.58 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|