C16H11ClFN5O — CID 68594477
3-(2-chloro-4-fluorophenyl)-12-methoxy-5-methyl-2,4,7,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 68594477) has the molecular formula C16H11ClFN5O and a molecular weight of 343.75 g/mol. Its IUPAC name is 3-(2-chloro-4-fluorophenyl)-12-methoxy-5-methyl-2,4,7,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 3-(2-chloro-4-fluorophenyl)-12-methoxy-5-methyl-2,4,7,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 68594477 |
| Molecular Formula | C16H11ClFN5O |
| Molecular Weight | 343.75 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 3-(2-chloro-4-fluorophenyl)-12-methoxy-5-methyl-2,4,7,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | COc1ccc2nnc3c(C)nc(-c4ccc(F)cc4Cl)n3c2n1 |
| InChI | InChI=1S/C16H11ClFN5O/c1-8-14-22-21-12-5-6-13(24-2)20-16(12)23(14)15(19-8)10-4-3-9(18)7-11(10)17/h3-7H,1-2H3 |
| InChIKey | CIKOPVDFPXGTDP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 65.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.75 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |