About (5-phenyl-1,3-thiazol-4-yl)carbamic acid;hydrochloride
(5-phenyl-1,3-thiazol-4-yl)carbamic acid;hydrochloride (PubChem CID 68594748) has the molecular formula C10H9ClN2O2S
and a molecular weight of 256.71 g/mol. Its IUPAC name is (5-phenyl-1,3-thiazol-4-yl)carbamic acid;hydrochloride.
Molecular Properties
| Compound Name | (5-phenyl-1,3-thiazol-4-yl)carbamic acid;hydrochloride |
| PubChem CID | 68594748 |
| Molecular Formula | C10H9ClN2O2S |
| Molecular Weight | 256.71 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | (5-phenyl-1,3-thiazol-4-yl)carbamic acid;hydrochloride |
| SMILES | Cl.O=C(O)Nc1ncsc1-c1ccccc1 |
| InChI | InChI=1S/C10H8N2O2S.ClH/c13-10(14)12-9-8(15-6-11-9)7-4-2-1-3-5-7;/h1-6,12H,(H,13,14);1H |
| InChIKey | CYMAGAUQZKZPOS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.71 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-phenyl-1,3-thiazol-4-yl)carbamic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-phenyl-1,3-thiazol-4-yl)carbamic acid;hydrochloride?
The IUPAC name of (5-phenyl-1,3-thiazol-4-yl)carbamic acid;hydrochloride (CID 68594748) is (5-phenyl-1,3-thiazol-4-yl)carbamic acid;hydrochloride.
What is the SMILES notation for (5-phenyl-1,3-thiazol-4-yl)carbamic acid;hydrochloride?
The canonical SMILES for (5-phenyl-1,3-thiazol-4-yl)carbamic acid;hydrochloride is Cl.O=C(O)Nc1ncsc1-c1ccccc1.
What is the InChIKey of (5-phenyl-1,3-thiazol-4-yl)carbamic acid;hydrochloride?
The InChIKey is CYMAGAUQZKZPOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2S.ClH/c13-10(14)12-9-8(15-6-11-9)7-4-2-1-3-5-7;/h1-6,12H,(H,13,14);1H.
What are the key properties of (5-phenyl-1,3-thiazol-4-yl)carbamic acid;hydrochloride?
(5-phenyl-1,3-thiazol-4-yl)carbamic acid;hydrochloride has a molecular weight of 256.71 g/mol, XLogP of 3.32, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-phenyl-1,3-thiazol-4-yl)carbamic acid;hydrochloride is sourced from PubChem (CID 68594748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).