About (4R)-7-chloro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-amine
(4R)-7-chloro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-amine (PubChem CID 68594798) has the molecular formula C11H12ClF2NO
and a molecular weight of 247.67 g/mol. Its IUPAC name is (4R)-7-chloro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-amine.
Molecular Properties
| Compound Name | (4R)-7-chloro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-amine |
| PubChem CID | 68594798 |
| Molecular Formula | C11H12ClF2NO |
| Molecular Weight | 247.67 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | (4R)-7-chloro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-amine |
| SMILES | N[C@@H]1CC(CF)(CF)Oc2cc(Cl)ccc21 |
| InChI | InChI=1S/C11H12ClF2NO/c12-7-1-2-8-9(15)4-11(5-13,6-14)16-10(8)3-7/h1-3,9H,4-6,15H2/t9-/m1/s1 |
| InChIKey | DLNXNPPSOLCMMN-SECBINFHSA-N |
| XLogP | 2.80 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.67 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-7-chloro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-7-chloro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-amine?
The IUPAC name of (4R)-7-chloro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-amine (CID 68594798) is (4R)-7-chloro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-amine.
What is the SMILES notation for (4R)-7-chloro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-amine?
The canonical SMILES for (4R)-7-chloro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-amine is N[C@@H]1CC(CF)(CF)Oc2cc(Cl)ccc21.
What is the InChIKey of (4R)-7-chloro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-amine?
The InChIKey is DLNXNPPSOLCMMN-SECBINFHSA-N. The full InChI is InChI=1S/C11H12ClF2NO/c12-7-1-2-8-9(15)4-11(5-13,6-14)16-10(8)3-7/h1-3,9H,4-6,15H2/t9-/m1/s1.
What are the key properties of (4R)-7-chloro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-amine?
(4R)-7-chloro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-amine has a molecular weight of 247.67 g/mol, XLogP of 2.80, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-7-chloro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-amine is sourced from PubChem (CID 68594798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).